C17H17FN2O2 — CID 8698667
4-[[2-(4-fluorophenyl)acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 8698667) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 4-[[2-(4-fluorophenyl)acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-(4-fluorophenyl)acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 8698667 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-[[2-(4-fluorophenyl)acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H17FN2O2/c1-20(2)17(22)13-5-9-15(10-6-13)19-16(21)11-12-3-7-14(18)8-4-12/h3-10H,11H2,1-2H3,(H,19,21) |
| InChIKey | CCAJTEJGWQYHSM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |