C14H20N2O3 — CID 79191364
4-(4-hydroxypentanoylamino)-N,N-dimethylbenzamide (PubChem CID 79191364) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 4-(4-hydroxypentanoylamino)-N,N-dimethylbenzamide.
| Compound Name | 4-(4-hydroxypentanoylamino)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 79191364 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-(4-hydroxypentanoylamino)-N,N-dimethylbenzamide |
| SMILES | CC(O)CCC(=O)Nc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-10(17)4-9-13(18)15-12-7-5-11(6-8-12)14(19)16(2)3/h5-8,10,17H,4,9H2,1-3H3,(H,15,18) |
| InChIKey | VMIMPPMRDGXHCS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |