C18H17F2N3O3 — CID 38107976
N-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-2,4-difluorobenzamide (PubChem CID 38107976) has the molecular formula C18H17F2N3O3 and a molecular weight of 361.35 g/mol. Its IUPAC name is N-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 38107976 |
| Molecular Formula | C18H17F2N3O3 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-2,4-difluorobenzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)CNC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H17F2N3O3/c1-23(2)18(26)11-3-6-13(7-4-11)22-16(24)10-21-17(25)14-8-5-12(19)9-15(14)20/h3-9H,10H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | KWHOFCOSXGYSPH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |