C22H17F2N3O3 — CID 55869846
N-[2-(3-benzamidoanilino)-2-oxoethyl]-2,4-difluorobenzamide (PubChem CID 55869846) has the molecular formula C22H17F2N3O3 and a molecular weight of 409.39 g/mol. Its IUPAC name is N-[2-(3-benzamidoanilino)-2-oxoethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-(3-benzamidoanilino)-2-oxoethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 55869846 |
| Molecular Formula | C22H17F2N3O3 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[2-(3-benzamidoanilino)-2-oxoethyl]-2,4-difluorobenzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1F)Nc1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H17F2N3O3/c23-15-9-10-18(19(24)11-15)22(30)25-13-20(28)26-16-7-4-8-17(12-16)27-21(29)14-5-2-1-3-6-14/h1-12H,13H2,(H,25,30)(H,26,28)(H,27,29) |
| InChIKey | CWVCUJFXORDVEL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |