C23H16FNO5S — CID 4164527
[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate (PubChem CID 4164527) has the molecular formula C23H16FNO5S and a molecular weight of 437.45 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 4164527 |
| Molecular Formula | C23H16FNO5S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate |
| SMILES | O=C1COc2ccc(C(=O)COC(=O)C(=Cc3ccc(F)cc3)c3cccs3)cc2N1 |
| InChI | InChI=1S/C23H16FNO5S/c24-16-6-3-14(4-7-16)10-17(21-2-1-9-31-21)23(28)30-12-19(26)15-5-8-20-18(11-15)25-22(27)13-29-20/h1-11H,12-13H2,(H,25,27) |
| InChIKey | SSUMLZQSZUOQTR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|