C22H17FN2O4S — CID 30993359
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] (Z)-3-phenyl-2-thiophen-2-ylprop-2-enoate (PubChem CID 30993359) has the molecular formula C22H17FN2O4S and a molecular weight of 424.45 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] (Z)-3-phenyl-2-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] (Z)-3-phenyl-2-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 30993359 |
| Molecular Formula | C22H17FN2O4S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] (Z)-3-phenyl-2-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C(=C/c1ccccc1)c1cccs1)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C22H17FN2O4S/c23-18-10-5-4-9-16(18)21(27)25-24-20(26)14-29-22(28)17(19-11-6-12-30-19)13-15-7-2-1-3-8-15/h1-13H,14H2,(H,24,26)(H,25,27)/b17-13+ |
| InChIKey | RFVOTVHULFFPDZ-GHRIWEEISA-N |
| XLogP | 3.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|