C13H10FN3O2S2 — CID 3324993
2-fluoro-N-[(thiophene-2-carbonylamino)carbamothioyl]benzamide (PubChem CID 3324993) has the molecular formula C13H10FN3O2S2 and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-fluoro-N-[(thiophene-2-carbonylamino)carbamothioyl]benzamide.
| Compound Name | 2-fluoro-N-[(thiophene-2-carbonylamino)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3324993 |
| Molecular Formula | C13H10FN3O2S2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-fluoro-N-[(thiophene-2-carbonylamino)carbamothioyl]benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccccc1F)c1cccs1 |
| InChI | InChI=1S/C13H10FN3O2S2/c14-9-5-2-1-4-8(9)11(18)15-13(20)17-16-12(19)10-6-3-7-21-10/h1-7H,(H,16,19)(H2,15,17,18,20) |
| InChIKey | HFPZXECPWJFBAV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|