C12H11N3OS2 — CID 17100252
N-(anilinocarbamothioyl)thiophene-2-carboxamide (PubChem CID 17100252) has the molecular formula C12H11N3OS2 and a molecular weight of 277.37 g/mol. Its IUPAC name is N-(anilinocarbamothioyl)thiophene-2-carboxamide.
| Compound Name | N-(anilinocarbamothioyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17100252 |
| Molecular Formula | C12H11N3OS2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | N-(anilinocarbamothioyl)thiophene-2-carboxamide |
| SMILES | O=C(NC(=S)NNc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C12H11N3OS2/c16-11(10-7-4-8-18-10)13-12(17)15-14-9-5-2-1-3-6-9/h1-8,14H,(H2,13,15,16,17) |
| InChIKey | FGKRMYJOHFRMFX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|