C22H15ClN4O2S2 — CID 86655537
6-chloro-2-phenyl-N-[(thiophene-2-carbonylamino)carbamothioyl]quinoline-4-carboxamide (PubChem CID 86655537) has the molecular formula C22H15ClN4O2S2 and a molecular weight of 466.98 g/mol. Its IUPAC name is 6-chloro-2-phenyl-N-[(thiophene-2-carbonylamino)carbamothioyl]quinoline-4-carboxamide.
| Compound Name | 6-chloro-2-phenyl-N-[(thiophene-2-carbonylamino)carbamothioyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 86655537 |
| Molecular Formula | C22H15ClN4O2S2 |
| Molecular Weight | 466.98 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 6-chloro-2-phenyl-N-[(thiophene-2-carbonylamino)carbamothioyl]quinoline-4-carboxamide |
| SMILES | O=C(NNC(=S)NC(=O)c1cc(-c2ccccc2)nc2ccc(Cl)cc12)c1cccs1 |
| InChI | InChI=1S/C22H15ClN4O2S2/c23-14-8-9-17-15(11-14)16(12-18(24-17)13-5-2-1-3-6-13)20(28)25-22(30)27-26-21(29)19-7-4-10-31-19/h1-12H,(H,26,29)(H2,25,27,28,30) |
| InChIKey | CAGYXXXPBJHJBR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|