C21H15N3O2S — CID 7600821
2-phenyl-N'-(thiophene-2-carbonyl)quinoline-4-carbohydrazide (PubChem CID 7600821) has the molecular formula C21H15N3O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is 2-phenyl-N'-(thiophene-2-carbonyl)quinoline-4-carbohydrazide.
| Compound Name | 2-phenyl-N'-(thiophene-2-carbonyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 7600821 |
| Molecular Formula | C21H15N3O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-phenyl-N'-(thiophene-2-carbonyl)quinoline-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2)nc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C21H15N3O2S/c25-20(23-24-21(26)19-11-6-12-27-19)16-13-18(14-7-2-1-3-8-14)22-17-10-5-4-9-15(16)17/h1-13H,(H,23,25)(H,24,26) |
| InChIKey | QIEXUDKVWAEHBE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|