C27H27N3OS — CID 6162815
2-(4-tert-butylphenyl)-N-[(Z)-1-thiophen-2-ylpropylideneamino]quinoline-4-carboxamide (PubChem CID 6162815) has the molecular formula C27H27N3OS and a molecular weight of 441.60 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[(Z)-1-thiophen-2-ylpropylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-[(Z)-1-thiophen-2-ylpropylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6162815 |
| Molecular Formula | C27H27N3OS |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[(Z)-1-thiophen-2-ylpropylideneamino]quinoline-4-carboxamide |
| SMILES | CC/C(=N/NC(=O)c1cc(-c2ccc(C(C)(C)C)cc2)nc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C27H27N3OS/c1-5-22(25-11-8-16-32-25)29-30-26(31)21-17-24(28-23-10-7-6-9-20(21)23)18-12-14-19(15-13-18)27(2,3)4/h6-17H,5H2,1-4H3,(H,30,31)/b29-22- |
| InChIKey | NJVNXSYGYKGALT-IADYIPOJSA-N |
| XLogP | 6.80 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|