C25H22N4O3S — CID 35699410
N-methyl-N-[2-[2-[2-(4-methylphenyl)quinoline-4-carbonyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 35699410) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-methyl-N-[2-[2-[2-(4-methylphenyl)quinoline-4-carbonyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-methyl-N-[2-[2-[2-(4-methylphenyl)quinoline-4-carbonyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 35699410 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-methyl-N-[2-[2-[2-(4-methylphenyl)quinoline-4-carbonyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NNC(=O)CN(C)C(=O)c3cccs3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H22N4O3S/c1-16-9-11-17(12-10-16)21-14-19(18-6-3-4-7-20(18)26-21)24(31)28-27-23(30)15-29(2)25(32)22-8-5-13-33-22/h3-14H,15H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | ISMSMACRUQNBJE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|