C20H18N2O2S — CID 14180706
2-[methyl-[2-(4-methylphenyl)quinoline-4-carbothioyl]amino]acetic acid (PubChem CID 14180706) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-[methyl-[2-(4-methylphenyl)quinoline-4-carbothioyl]amino]acetic acid.
| Compound Name | 2-[methyl-[2-(4-methylphenyl)quinoline-4-carbothioyl]amino]acetic acid |
|---|---|
| PubChem CID | 14180706 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-[methyl-[2-(4-methylphenyl)quinoline-4-carbothioyl]amino]acetic acid |
| SMILES | Cc1ccc(-c2cc(C(=S)N(C)CC(=O)O)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C20H18N2O2S/c1-13-7-9-14(10-8-13)18-11-16(20(25)22(2)12-19(23)24)15-5-3-4-6-17(15)21-18/h3-11H,12H2,1-2H3,(H,23,24) |
| InChIKey | JBPLZIBIJWMFNL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|