C27H25N3O2 — CID 8964759
N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 8964759) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 8964759 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | CNC(=O)c1ccc(CN(C)C(=O)c2cc(-c3ccc(C)cc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C27H25N3O2/c1-18-8-12-20(13-9-18)25-16-23(22-6-4-5-7-24(22)29-25)27(32)30(3)17-19-10-14-21(15-11-19)26(31)28-2/h4-16H,17H2,1-3H3,(H,28,31) |
| InChIKey | MZYVNYMVEYPYPA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |