C24H18N4O — CID 39858915
N-[(4-cyanophenyl)methyl]-N-methyl-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 39858915) has the molecular formula C24H18N4O and a molecular weight of 378.44 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-N-methyl-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-N-methyl-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 39858915 |
| Molecular Formula | C24H18N4O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-N-methyl-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | CN(Cc1ccc(C#N)cc1)C(=O)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C24H18N4O/c1-28(16-18-10-8-17(14-25)9-11-18)24(29)21-13-23(19-5-4-12-26-15-19)27-22-7-3-2-6-20(21)22/h2-13,15H,16H2,1H3 |
| InChIKey | WDFQIVUBBNNKDJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |