C26H22N4O2 — CID 78800017
N-(2-cyanoethyl)-2-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)quinoline-4-carboxamide (PubChem CID 78800017) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)quinoline-4-carboxamide.
| Compound Name | N-(2-cyanoethyl)-2-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 78800017 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-(2-cyanoethyl)-2-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N(CCC#N)Cc3cccnc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H22N4O2/c1-32-21-11-9-20(10-12-21)25-16-23(22-7-2-3-8-24(22)29-25)26(31)30(15-5-13-27)18-19-6-4-14-28-17-19/h2-4,6-12,14,16-17H,5,15,18H2,1H3 |
| InChIKey | ZFNIMZIYFVQJEI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |