C26H23ClN2O — CID 7535435
2-(4-chlorophenyl)-N-[(4-ethylphenyl)methyl]-N-methylquinoline-4-carboxamide (PubChem CID 7535435) has the molecular formula C26H23ClN2O and a molecular weight of 414.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(4-ethylphenyl)methyl]-N-methylquinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(4-ethylphenyl)methyl]-N-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 7535435 |
| Molecular Formula | C26H23ClN2O |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(4-ethylphenyl)methyl]-N-methylquinoline-4-carboxamide |
| SMILES | CCc1ccc(CN(C)C(=O)c2cc(-c3ccc(Cl)cc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H23ClN2O/c1-3-18-8-10-19(11-9-18)17-29(2)26(30)23-16-25(20-12-14-21(27)15-13-20)28-24-7-5-4-6-22(23)24/h4-16H,3,17H2,1-2H3 |
| InChIKey | CAJZKIKBPGDODI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |