C24H21ClN2OS — CID 7535473
2-(5-chlorothiophen-2-yl)-N-[(4-ethylphenyl)methyl]-N-methylquinoline-4-carboxamide (PubChem CID 7535473) has the molecular formula C24H21ClN2OS and a molecular weight of 420.97 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-[(4-ethylphenyl)methyl]-N-methylquinoline-4-carboxamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-[(4-ethylphenyl)methyl]-N-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 7535473 |
| Molecular Formula | C24H21ClN2OS |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-[(4-ethylphenyl)methyl]-N-methylquinoline-4-carboxamide |
| SMILES | CCc1ccc(CN(C)C(=O)c2cc(-c3ccc(Cl)s3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H21ClN2OS/c1-3-16-8-10-17(11-9-16)15-27(2)24(28)19-14-21(22-12-13-23(25)29-22)26-20-7-5-4-6-18(19)20/h4-14H,3,15H2,1-2H3 |
| InChIKey | SJMAFLMYYNMXBA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |