C26H29ClN2OS — CID 4610681
2-(5-chlorothiophen-2-yl)-N,N-dicyclohexylquinoline-4-carboxamide (PubChem CID 4610681) has the molecular formula C26H29ClN2OS and a molecular weight of 453.05 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N,N-dicyclohexylquinoline-4-carboxamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N,N-dicyclohexylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4610681 |
| Molecular Formula | C26H29ClN2OS |
| Molecular Weight | 453.05 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N,N-dicyclohexylquinoline-4-carboxamide |
| SMILES | O=C(c1cc(-c2ccc(Cl)s2)nc2ccccc12)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C26H29ClN2OS/c27-25-16-15-24(31-25)23-17-21(20-13-7-8-14-22(20)28-23)26(30)29(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h7-8,13-19H,1-6,9-12H2 |
| InChIKey | XIFUJPLBIOHHQS-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.05 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |