About N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide
N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide (PubChem CID 4176250) has the molecular formula C30H36N2O
and a molecular weight of 440.63 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide |
| PubChem CID | 4176250 |
| Molecular Formula | C30H36N2O |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N(C3CCCCC3)C3CCCCC3)c3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C30H36N2O/c1-21-17-18-25(22(2)19-21)29-20-27(26-15-9-10-16-28(26)31-29)30(33)32(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h9-10,15-20,23-24H,3-8,11-14H2,1-2H3 |
| InChIKey | USOKQRMUPYMTDV-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide?
The IUPAC name of N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide (CID 4176250) is N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide.
What is the SMILES notation for N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide?
The canonical SMILES for N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide is Cc1ccc(-c2cc(C(=O)N(C3CCCCC3)C3CCCCC3)c3ccccc3n2)c(C)c1.
What is the InChIKey of N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide?
The InChIKey is USOKQRMUPYMTDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H36N2O/c1-21-17-18-25(22(2)19-21)29-20-27(26-15-9-10-16-28(26)31-29)30(33)32(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h9-10,15-20,23-24H,3-8,11-14H2,1-2H3.
What are the key properties of N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide?
N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide has a molecular weight of 440.63 g/mol, XLogP of 7.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide is sourced from PubChem (CID 4176250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).