C30H36N2O — CID 4176250
N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide (PubChem CID 4176250) has the molecular formula C30H36N2O and a molecular weight of 440.63 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide.
| Compound Name | N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4176250 |
| Molecular Formula | C30H36N2O |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | N,N-dicyclohexyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N(C3CCCCC3)C3CCCCC3)c3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C30H36N2O/c1-21-17-18-25(22(2)19-21)29-20-27(26-15-9-10-16-28(26)31-29)30(33)32(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h9-10,15-20,23-24H,3-8,11-14H2,1-2H3 |
| InChIKey | USOKQRMUPYMTDV-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |