C23H24N2O3 — CID 60612986
2-(2,4-dimethylphenyl)-N-(oxan-2-yloxy)quinoline-4-carboxamide (PubChem CID 60612986) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-(oxan-2-yloxy)quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-(oxan-2-yloxy)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 60612986 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-(oxan-2-yloxy)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NOC3CCCCO3)c3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C23H24N2O3/c1-15-10-11-17(16(2)13-15)21-14-19(18-7-3-4-8-20(18)24-21)23(26)25-28-22-9-5-6-12-27-22/h3-4,7-8,10-11,13-14,22H,5-6,9,12H2,1-2H3,(H,25,26) |
| InChIKey | JDWFMHCOFIVRAD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|