C26H18ClN3OS — CID 4155187
N-(4-anilinophenyl)-2-(5-chlorothiophen-2-yl)quinoline-4-carboxamide (PubChem CID 4155187) has the molecular formula C26H18ClN3OS and a molecular weight of 455.97 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-(5-chlorothiophen-2-yl)quinoline-4-carboxamide.
| Compound Name | N-(4-anilinophenyl)-2-(5-chlorothiophen-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4155187 |
| Molecular Formula | C26H18ClN3OS |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N-(4-anilinophenyl)-2-(5-chlorothiophen-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccccc2)cc1)c1cc(-c2ccc(Cl)s2)nc2ccccc12 |
| InChI | InChI=1S/C26H18ClN3OS/c27-25-15-14-24(32-25)23-16-21(20-8-4-5-9-22(20)30-23)26(31)29-19-12-10-18(11-13-19)28-17-6-2-1-3-7-17/h1-16,28H,(H,29,31) |
| InChIKey | GTWGTYQFUOYMEZ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |