C25H21N3O — CID 6092876
2-(4-methylphenyl)-N-[(Z)-1-phenylethylideneamino]quinoline-4-carboxamide (PubChem CID 6092876) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-[(Z)-1-phenylethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-methylphenyl)-N-[(Z)-1-phenylethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6092876 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-(4-methylphenyl)-N-[(Z)-1-phenylethylideneamino]quinoline-4-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(-c2ccc(C)cc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H21N3O/c1-17-12-14-20(15-13-17)24-16-22(21-10-6-7-11-23(21)26-24)25(29)28-27-18(2)19-8-4-3-5-9-19/h3-16H,1-2H3,(H,28,29)/b27-18- |
| InChIKey | RHKORTPIMLFDRG-IMRQLAEWSA-N |
| XLogP | 5.36 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|