C24H17Cl2N3O — CID 3806436
N-[1-(3,4-dichlorophenyl)ethylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 3806436) has the molecular formula C24H17Cl2N3O and a molecular weight of 434.33 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3806436 |
| Molecular Formula | C24H17Cl2N3O |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(-c2ccccc2)nc2ccccc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H17Cl2N3O/c1-15(17-11-12-20(25)21(26)13-17)28-29-24(30)19-14-23(16-7-3-2-4-8-16)27-22-10-6-5-9-18(19)22/h2-14H,1H3,(H,29,30) |
| InChIKey | OBPKTLIAOZHVSA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|