C30H31N3O — CID 4093651
N-[1-(4-hexylphenyl)ethylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 4093651) has the molecular formula C30H31N3O and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[1-(4-hexylphenyl)ethylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[1-(4-hexylphenyl)ethylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4093651 |
| Molecular Formula | C30H31N3O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | N-[1-(4-hexylphenyl)ethylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | CCCCCCc1ccc(C(C)=NNC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C30H31N3O/c1-3-4-5-7-12-23-17-19-24(20-18-23)22(2)32-33-30(34)27-21-29(25-13-8-6-9-14-25)31-28-16-11-10-15-26(27)28/h6,8-11,13-21H,3-5,7,12H2,1-2H3,(H,33,34) |
| InChIKey | WPLPDKNKVJAUEH-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|