C29H24Cl2N4O2 — CID 5045590
N-[1-[4-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-2-(3,4-dichlorophenyl)quinoline-4-carboxamide (PubChem CID 5045590) has the molecular formula C29H24Cl2N4O2 and a molecular weight of 531.44 g/mol. Its IUPAC name is N-[1-[4-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-2-(3,4-dichlorophenyl)quinoline-4-carboxamide.
| Compound Name | N-[1-[4-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-2-(3,4-dichlorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5045590 |
| Molecular Formula | C29H24Cl2N4O2 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | N-[1-[4-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-2-(3,4-dichlorophenyl)quinoline-4-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12)c1ccc(NC(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C29H24Cl2N4O2/c1-17(18-9-12-21(13-10-18)32-28(36)19-5-4-6-19)34-35-29(37)23-16-27(20-11-14-24(30)25(31)15-20)33-26-8-3-2-7-22(23)26/h2-3,7-16,19H,4-6H2,1H3,(H,32,36)(H,35,37) |
| InChIKey | QWCICXVQCRUHPX-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|