C32H28N4O3 — CID 5146403
N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]-2-(4-propan-2-ylphenyl)quinoline-4-carboxamide (PubChem CID 5146403) has the molecular formula C32H28N4O3 and a molecular weight of 516.60 g/mol. Its IUPAC name is N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]-2-(4-propan-2-ylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]-2-(4-propan-2-ylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5146403 |
| Molecular Formula | C32H28N4O3 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]-2-(4-propan-2-ylphenyl)quinoline-4-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(-c2ccc(C(C)C)cc2)nc2ccccc12)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C32H28N4O3/c1-20(2)22-10-12-24(13-11-22)29-19-27(26-7-4-5-8-28(26)34-29)31(37)36-35-21(3)23-14-16-25(17-15-23)33-32(38)30-9-6-18-39-30/h4-20H,1-3H3,(H,33,38)(H,36,37) |
| InChIKey | XIQYJHHQFZNGGD-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|