C29H21ClN4O3 — CID 5198522
2-(4-chlorophenyl)-N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]quinoline-4-carboxamide (PubChem CID 5198522) has the molecular formula C29H21ClN4O3 and a molecular weight of 508.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5198522 |
| Molecular Formula | C29H21ClN4O3 |
| Molecular Weight | 508.97 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]quinoline-4-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(-c2ccc(Cl)cc2)nc2ccccc12)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C29H21ClN4O3/c1-18(19-10-14-22(15-11-19)31-29(36)27-7-4-16-37-27)33-34-28(35)24-17-26(20-8-12-21(30)13-9-20)32-25-6-3-2-5-23(24)25/h2-17H,1H3,(H,31,36)(H,34,35) |
| InChIKey | WDGPOCYCIRYZMQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.97 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|