C30H24N4O4 — CID 4073542
N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]-2-(2-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 4073542) has the molecular formula C30H24N4O4 and a molecular weight of 504.55 g/mol. Its IUPAC name is N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]-2-(2-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]-2-(2-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4073542 |
| Molecular Formula | C30H24N4O4 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | N-[1-[4-(furan-2-carbonylamino)phenyl]ethylideneamino]-2-(2-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccccc1-c1cc(C(=O)NN=C(C)c2ccc(NC(=O)c3ccco3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C30H24N4O4/c1-19(20-13-15-21(16-14-20)31-30(36)28-12-7-17-38-28)33-34-29(35)24-18-26(23-9-4-6-11-27(23)37-2)32-25-10-5-3-8-22(24)25/h3-18H,1-2H3,(H,31,36)(H,34,35) |
| InChIKey | RLSRXJIDGBLLRY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|