C25H22N4O3 — CID 26871461
2-(2,4-dimethoxyphenyl)-N-[(Z)-1-pyridin-3-ylethylideneamino]quinoline-4-carboxamide (PubChem CID 26871461) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[(Z)-1-pyridin-3-ylethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[(Z)-1-pyridin-3-ylethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 26871461 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[(Z)-1-pyridin-3-ylethylideneamino]quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N/N=C(/C)c3cccnc3)c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C25H22N4O3/c1-16(17-7-6-12-26-15-17)28-29-25(30)21-14-23(27-22-9-5-4-8-19(21)22)20-11-10-18(31-2)13-24(20)32-3/h4-15H,1-3H3,(H,29,30)/b28-16- |
| InChIKey | SOKIFAVMNZNZEO-NTFVMDSBSA-N |
| XLogP | 4.47 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|