C24H20N4O3 — CID 1226456
2-(2,4-dimethoxyphenyl)-N-(pyridin-3-ylmethylideneamino)quinoline-4-carboxamide (PubChem CID 1226456) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-(pyridin-3-ylmethylideneamino)quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-(pyridin-3-ylmethylideneamino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 1226456 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-(pyridin-3-ylmethylideneamino)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NN=Cc3cccnc3)c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C24H20N4O3/c1-30-17-9-10-19(23(12-17)31-2)22-13-20(18-7-3-4-8-21(18)27-22)24(29)28-26-15-16-6-5-11-25-14-16/h3-15H,1-2H3,(H,28,29) |
| InChIKey | ZIKXBRICBNAKKS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|