C25H20ClN3O3 — CID 6873344
N-[(E)-(3-chlorophenyl)methylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 6873344) has the molecular formula C25H20ClN3O3 and a molecular weight of 445.91 g/mol. Its IUPAC name is N-[(E)-(3-chlorophenyl)methylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(E)-(3-chlorophenyl)methylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6873344 |
| Molecular Formula | C25H20ClN3O3 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[(E)-(3-chlorophenyl)methylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)N/N=C/c3cccc(Cl)c3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H20ClN3O3/c1-31-18-10-11-24(32-2)21(13-18)23-14-20(19-8-3-4-9-22(19)28-23)25(30)29-27-15-16-6-5-7-17(26)12-16/h3-15H,1-2H3,(H,29,30)/b27-15+ |
| InChIKey | AYGUWHNOMPRQQB-JFLMPSFJSA-N |
| XLogP | 5.34 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|