C25H20BrN3O4 — CID 135781971
N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 135781971) has the molecular formula C25H20BrN3O4 and a molecular weight of 506.36 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 135781971 |
| Molecular Formula | C25H20BrN3O4 |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)N/N=C\c3cc(Br)ccc3O)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H20BrN3O4/c1-32-17-8-10-24(33-2)20(12-17)22-13-19(18-5-3-4-6-21(18)28-22)25(31)29-27-14-15-11-16(26)7-9-23(15)30/h3-14,30H,1-2H3,(H,29,31)/b27-14- |
| InChIKey | ZLQBFTXQGZFGKS-VYYCAZPPSA-N |
| XLogP | 5.15 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|