C24H18BrN3O4 — CID 135605727
2-(4-bromophenyl)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-6-methoxyquinoline-4-carboxamide (PubChem CID 135605727) has the molecular formula C24H18BrN3O4 and a molecular weight of 492.33 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-6-methoxyquinoline-4-carboxamide.
| Compound Name | 2-(4-bromophenyl)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-6-methoxyquinoline-4-carboxamide |
|---|---|
| PubChem CID | 135605727 |
| Molecular Formula | C24H18BrN3O4 |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-6-methoxyquinoline-4-carboxamide |
| SMILES | COc1ccc2nc(-c3ccc(Br)cc3)cc(C(=O)N/N=C/c3ccc(O)cc3O)c2c1 |
| InChI | InChI=1S/C24H18BrN3O4/c1-32-18-8-9-21-19(11-18)20(12-22(27-21)14-2-5-16(25)6-3-14)24(31)28-26-13-15-4-7-17(29)10-23(15)30/h2-13,29-30H,1H3,(H,28,31)/b26-13+ |
| InChIKey | HOUKLPYUDJZZLM-LGJNPRDNSA-N |
| XLogP | 4.85 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|