C25H22BrN3O3S — CID 3452259
N-[1-(5-bromothiophen-2-yl)propylideneamino]-2-(2,4-dimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 3452259) has the molecular formula C25H22BrN3O3S and a molecular weight of 524.44 g/mol. Its IUPAC name is N-[1-(5-bromothiophen-2-yl)propylideneamino]-2-(2,4-dimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[1-(5-bromothiophen-2-yl)propylideneamino]-2-(2,4-dimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3452259 |
| Molecular Formula | C25H22BrN3O3S |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | N-[1-(5-bromothiophen-2-yl)propylideneamino]-2-(2,4-dimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | CCC(=NNC(=O)c1cc(-c2ccc(OC)cc2OC)nc2ccccc12)c1ccc(Br)s1 |
| InChI | InChI=1S/C25H22BrN3O3S/c1-4-19(23-11-12-24(26)33-23)28-29-25(30)18-14-21(27-20-8-6-5-7-16(18)20)17-10-9-15(31-2)13-22(17)32-3/h5-14H,4H2,1-3H3,(H,29,30) |
| InChIKey | CPNASVFNPMXPAD-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|