C25H30N2O3 — CID 4565614
2-(2,4-dimethoxyphenyl)-N-heptylquinoline-4-carboxamide (PubChem CID 4565614) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-heptylquinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-heptylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4565614 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-heptylquinoline-4-carboxamide |
| SMILES | CCCCCCCNC(=O)c1cc(-c2ccc(OC)cc2OC)nc2ccccc12 |
| InChI | InChI=1S/C25H30N2O3/c1-4-5-6-7-10-15-26-25(28)21-17-23(27-22-12-9-8-11-19(21)22)20-14-13-18(29-2)16-24(20)30-3/h8-9,11-14,16-17H,4-7,10,15H2,1-3H3,(H,26,28) |
| InChIKey | FHZOTZJGHMZFIU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|