C25H23N3O3 — CID 42749556
2-(2,4-dimethoxyphenyl)-N-(2-pyridin-2-ylethyl)quinoline-4-carboxamide (PubChem CID 42749556) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-(2-pyridin-2-ylethyl)quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-(2-pyridin-2-ylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 42749556 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-(2-pyridin-2-ylethyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCc3ccccn3)c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C25H23N3O3/c1-30-18-10-11-20(24(15-18)31-2)23-16-21(19-8-3-4-9-22(19)28-23)25(29)27-14-12-17-7-5-6-13-26-17/h3-11,13,15-16H,12,14H2,1-2H3,(H,27,29) |
| InChIKey | LGPBCODWMNHMHT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |