C28H22N2O3 — CID 4659976
2-(2,4-dimethoxyphenyl)-N-naphthalen-2-ylquinoline-4-carboxamide (PubChem CID 4659976) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-naphthalen-2-ylquinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-naphthalen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4659976 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-naphthalen-2-ylquinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccc4ccccc4c3)c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C28H22N2O3/c1-32-21-13-14-23(27(16-21)33-2)26-17-24(22-9-5-6-10-25(22)30-26)28(31)29-20-12-11-18-7-3-4-8-19(18)15-20/h3-17H,1-2H3,(H,29,31) |
| InChIKey | FQBLDZBNXYYCLH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |