C24H19FN2O3 — CID 1000946
2-(2,4-dimethoxyphenyl)-N-(3-fluorophenyl)quinoline-4-carboxamide (PubChem CID 1000946) has the molecular formula C24H19FN2O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-(3-fluorophenyl)quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-(3-fluorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 1000946 |
| Molecular Formula | C24H19FN2O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-(3-fluorophenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3cccc(F)c3)c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C24H19FN2O3/c1-29-17-10-11-19(23(13-17)30-2)22-14-20(18-8-3-4-9-21(18)27-22)24(28)26-16-7-5-6-15(25)12-16/h3-14H,1-2H3,(H,26,28) |
| InChIKey | SRLFAAOGGPAYNS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |