C26H22N2O5 — CID 3464523
methyl 4-[[2-(2,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]benzoate (PubChem CID 3464523) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is methyl 4-[[2-(2,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(2,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3464523 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | methyl 4-[[2-(2,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc(-c3ccc(OC)cc3OC)nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H22N2O5/c1-31-18-12-13-20(24(14-18)32-2)23-15-21(19-6-4-5-7-22(19)28-23)25(29)27-17-10-8-16(9-11-17)26(30)33-3/h4-15H,1-3H3,(H,27,29) |
| InChIKey | MZYSFCXUJUQMRO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |