C27H27N3O3S — CID 6106511
2-(2,4-dimethoxyphenyl)-N-[(E)-1-(5-ethylthiophen-2-yl)propylideneamino]quinoline-4-carboxamide (PubChem CID 6106511) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[(E)-1-(5-ethylthiophen-2-yl)propylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[(E)-1-(5-ethylthiophen-2-yl)propylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6106511 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[(E)-1-(5-ethylthiophen-2-yl)propylideneamino]quinoline-4-carboxamide |
| SMILES | CC/C(=N\NC(=O)c1cc(-c2ccc(OC)cc2OC)nc2ccccc12)c1ccc(CC)s1 |
| InChI | InChI=1S/C27H27N3O3S/c1-5-18-12-14-26(34-18)22(6-2)29-30-27(31)21-16-24(28-23-10-8-7-9-19(21)23)20-13-11-17(32-3)15-25(20)33-4/h7-16H,5-6H2,1-4H3,(H,30,31)/b29-22+ |
| InChIKey | STDFDSBJLMFNRK-QUPMIFSKSA-N |
| XLogP | 6.09 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|