C30H30N4O4 — CID 5455046
2-(2,4-dimethoxyphenyl)-N-[(Z)-1-(4-morpholin-4-ylphenyl)ethylideneamino]quinoline-4-carboxamide (PubChem CID 5455046) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[(Z)-1-(4-morpholin-4-ylphenyl)ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[(Z)-1-(4-morpholin-4-ylphenyl)ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5455046 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[(Z)-1-(4-morpholin-4-ylphenyl)ethylideneamino]quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N/N=C(/C)c3ccc(N4CCOCC4)cc3)c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C30H30N4O4/c1-20(21-8-10-22(11-9-21)34-14-16-38-17-15-34)32-33-30(35)26-19-28(31-27-7-5-4-6-24(26)27)25-13-12-23(36-2)18-29(25)37-3/h4-13,18-19H,14-17H2,1-3H3,(H,33,35)/b32-20- |
| InChIKey | XVDAQSNEKAZRTQ-RGXNXFOYSA-N |
| XLogP | 4.91 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|