C32H32N4O4 — CID 6162942
N-[(Z)-1-[4-(cyclopentanecarbonylamino)phenyl]ethylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 6162942) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is N-[(Z)-1-[4-(cyclopentanecarbonylamino)phenyl]ethylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(Z)-1-[4-(cyclopentanecarbonylamino)phenyl]ethylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6162942 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | N-[(Z)-1-[4-(cyclopentanecarbonylamino)phenyl]ethylideneamino]-2-(2,5-dimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)N/N=C(/C)c3ccc(NC(=O)C4CCCC4)cc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C32H32N4O4/c1-20(21-12-14-23(15-13-21)33-31(37)22-8-4-5-9-22)35-36-32(38)26-19-29(34-28-11-7-6-10-25(26)28)27-18-24(39-2)16-17-30(27)40-3/h6-7,10-19,22H,4-5,8-9H2,1-3H3,(H,33,37)(H,36,38)/b35-20- |
| InChIKey | XTYUIYPWAAGOIX-OJYCWLPVSA-N |
| XLogP | 6.20 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|