C25H21N3O4 — CID 135621517
N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-2-(2-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 135621517) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-2-(2-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-2-(2-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 135621517 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-2-(2-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccccc1-c1cc(C(=O)N/N=C(\C)c2cc(O)ccc2O)c2ccccc2n1 |
| InChI | InChI=1S/C25H21N3O4/c1-15(19-13-16(29)11-12-23(19)30)27-28-25(31)20-14-22(18-8-4-6-10-24(18)32-2)26-21-9-5-3-7-17(20)21/h3-14,29-30H,1-2H3,(H,28,31)/b27-15+ |
| InChIKey | JWNZJNZWNBHJSP-JFLMPSFJSA-N |
| XLogP | 4.48 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|