C26H25N3O2S — CID 5122874
2-(4-ethoxyphenyl)-N-[1-(5-ethylthiophen-2-yl)ethylideneamino]quinoline-4-carboxamide (PubChem CID 5122874) has the molecular formula C26H25N3O2S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[1-(5-ethylthiophen-2-yl)ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[1-(5-ethylthiophen-2-yl)ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5122874 |
| Molecular Formula | C26H25N3O2S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[1-(5-ethylthiophen-2-yl)ethylideneamino]quinoline-4-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)NN=C(C)c3ccc(CC)s3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H25N3O2S/c1-4-20-14-15-25(32-20)17(3)28-29-26(30)22-16-24(27-23-9-7-6-8-21(22)23)18-10-12-19(13-11-18)31-5-2/h6-16H,4-5H2,1-3H3,(H,29,30) |
| InChIKey | KLJINHHZQPPXQQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|