C26H24ClN3OS — CID 4205609
2-(4-tert-butylphenyl)-N-[1-(5-chlorothiophen-2-yl)ethylideneamino]quinoline-4-carboxamide (PubChem CID 4205609) has the molecular formula C26H24ClN3OS and a molecular weight of 462.02 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[1-(5-chlorothiophen-2-yl)ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-[1-(5-chlorothiophen-2-yl)ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4205609 |
| Molecular Formula | C26H24ClN3OS |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[1-(5-chlorothiophen-2-yl)ethylideneamino]quinoline-4-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(-c2ccc(C(C)(C)C)cc2)nc2ccccc12)c1ccc(Cl)s1 |
| InChI | InChI=1S/C26H24ClN3OS/c1-16(23-13-14-24(27)32-23)29-30-25(31)20-15-22(28-21-8-6-5-7-19(20)21)17-9-11-18(12-10-17)26(2,3)4/h5-15H,1-4H3,(H,30,31) |
| InChIKey | IGMRGCXJBXGKBK-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|