C28H26BrN3O2 — CID 135647823
6-bromo-N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]-2-(4-hydroxyphenyl)quinoline-4-carboxamide (PubChem CID 135647823) has the molecular formula C28H26BrN3O2 and a molecular weight of 516.44 g/mol. Its IUPAC name is 6-bromo-N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]-2-(4-hydroxyphenyl)quinoline-4-carboxamide.
| Compound Name | 6-bromo-N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]-2-(4-hydroxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 135647823 |
| Molecular Formula | C28H26BrN3O2 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 6-bromo-N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]-2-(4-hydroxyphenyl)quinoline-4-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(-c2ccc(O)cc2)nc2ccc(Br)cc12)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H26BrN3O2/c1-17(18-5-9-20(10-6-18)28(2,3)4)31-32-27(34)24-16-26(19-7-12-22(33)13-8-19)30-25-14-11-21(29)15-23(24)25/h5-16,33H,1-4H3,(H,32,34)/b31-17- |
| InChIKey | LBQGEWCOWVIEJJ-LJUMEUDFSA-N |
| XLogP | 6.82 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|