C21H18BrN3O2 — CID 4671456
6-bromo-2-cyclopropyl-N-[1-(4-hydroxyphenyl)ethylideneamino]quinoline-4-carboxamide (PubChem CID 4671456) has the molecular formula C21H18BrN3O2 and a molecular weight of 424.30 g/mol. Its IUPAC name is 6-bromo-2-cyclopropyl-N-[1-(4-hydroxyphenyl)ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 6-bromo-2-cyclopropyl-N-[1-(4-hydroxyphenyl)ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4671456 |
| Molecular Formula | C21H18BrN3O2 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 6-bromo-2-cyclopropyl-N-[1-(4-hydroxyphenyl)ethylideneamino]quinoline-4-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(C2CC2)nc2ccc(Br)cc12)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H18BrN3O2/c1-12(13-4-7-16(26)8-5-13)24-25-21(27)18-11-20(14-2-3-14)23-19-9-6-15(22)10-17(18)19/h4-11,14,26H,2-3H2,1H3,(H,25,27) |
| InChIKey | BZXNZWIPIQRJBY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|