C37H34Cl2N4O4 — CID 17087433
N-[(E)-1-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]ethylideneamino]-2-(2-propan-2-yloxyphenyl)quinoline-4-carboxamide (PubChem CID 17087433) has the molecular formula C37H34Cl2N4O4 and a molecular weight of 669.61 g/mol. Its IUPAC name is N-[(E)-1-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]ethylideneamino]-2-(2-propan-2-yloxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(E)-1-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]ethylideneamino]-2-(2-propan-2-yloxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 17087433 |
| Molecular Formula | C37H34Cl2N4O4 |
| Molecular Weight | 669.61 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | N-[(E)-1-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]ethylideneamino]-2-(2-propan-2-yloxyphenyl)quinoline-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cc(-c2ccccc2OC(C)C)nc2ccccc12)c1ccc(NC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C37H34Cl2N4O4/c1-23(2)47-34-12-7-5-10-29(34)33-22-30(28-9-4-6-11-32(28)41-33)37(45)43-42-24(3)25-14-17-27(18-15-25)40-36(44)13-8-20-46-35-19-16-26(38)21-31(35)39/h4-7,9-12,14-19,21-23H,8,13,20H2,1-3H3,(H,40,44)(H,43,45)/b42-24+ |
| InChIKey | YMJSPEBHYWUHAU-HAPYPFFUSA-N |
| XLogP | 8.95 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.61 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|