C21H16N4O2 — CID 4687807
N-[1-(furan-2-yl)ethylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 4687807) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-[1-(furan-2-yl)ethylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-[1-(furan-2-yl)ethylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4687807 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[1-(furan-2-yl)ethylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(-c2cccnc2)nc2ccccc12)c1ccco1 |
| InChI | InChI=1S/C21H16N4O2/c1-14(20-9-5-11-27-20)24-25-21(26)17-12-19(15-6-4-10-22-13-15)23-18-8-3-2-7-16(17)18/h2-13H,1H3,(H,25,26) |
| InChIKey | DYJOOAIPBCKTKU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|